C26H32N6O3 — CID 25014844
[3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]-methylamino]phenyl]methanol (PubChem CID 25014844) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is [3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]-methylamino]phenyl]methanol.
| Compound Name | [3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]-methylamino]phenyl]methanol |
|---|---|
| PubChem CID | 25014844 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | [3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]-methylamino]phenyl]methanol |
| SMILES | CN(c1cccc(CO)c1)c1ccnc(Nc2cc(N3CCOCC3)cc(N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C26H32N6O3/c1-30(22-4-2-3-20(15-22)19-33)25-5-6-27-26(29-25)28-21-16-23(31-7-11-34-12-8-31)18-24(17-21)32-9-13-35-14-10-32/h2-6,15-18,33H,7-14,19H2,1H3,(H,27,28,29) |
| InChIKey | LWLYTBIEINCWJQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |