C21H20ClF2N5O — CID 25015407
4-N-(3-chloro-2,4-difluorophenyl)-4-N-methyl-2-N-(3-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 25015407) has the molecular formula C21H20ClF2N5O and a molecular weight of 431.87 g/mol. Its IUPAC name is 4-N-(3-chloro-2,4-difluorophenyl)-4-N-methyl-2-N-(3-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-chloro-2,4-difluorophenyl)-4-N-methyl-2-N-(3-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25015407 |
| Molecular Formula | C21H20ClF2N5O |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-N-(3-chloro-2,4-difluorophenyl)-4-N-methyl-2-N-(3-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | CN(c1ccnc(Nc2cccc(N3CCOCC3)c2)n1)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C21H20ClF2N5O/c1-28(17-6-5-16(23)19(22)20(17)24)18-7-8-25-21(27-18)26-14-3-2-4-15(13-14)29-9-11-30-12-10-29/h2-8,13H,9-12H2,1H3,(H,25,26,27) |
| InChIKey | GYPNAZNWEAXCRM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|