C23H23ClN6O — CID 46195238
4-(7-chloro-1-ethylpyrrolo[2,3-c]pyridin-3-yl)-N-(3-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 46195238) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is 4-(7-chloro-1-ethylpyrrolo[2,3-c]pyridin-3-yl)-N-(3-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(7-chloro-1-ethylpyrrolo[2,3-c]pyridin-3-yl)-N-(3-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 46195238 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-(7-chloro-1-ethylpyrrolo[2,3-c]pyridin-3-yl)-N-(3-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | CCn1cc(-c2ccnc(Nc3cccc(N4CCOCC4)c3)n2)c2ccnc(Cl)c21 |
| InChI | InChI=1S/C23H23ClN6O/c1-2-29-15-19(18-6-8-25-22(24)21(18)29)20-7-9-26-23(28-20)27-16-4-3-5-17(14-16)30-10-12-31-13-11-30/h3-9,14-15H,2,10-13H2,1H3,(H,26,27,28) |
| InChIKey | ZTJMDERJRUHPCB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|