C25H28ClN7 — CID 66551695
4-(5-chloro-7-methyl-1-propylpyrrolo[3,2-b]pyridin-3-yl)-N-(3-piperazin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 66551695) has the molecular formula C25H28ClN7 and a molecular weight of 462.00 g/mol. Its IUPAC name is 4-(5-chloro-7-methyl-1-propylpyrrolo[3,2-b]pyridin-3-yl)-N-(3-piperazin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(5-chloro-7-methyl-1-propylpyrrolo[3,2-b]pyridin-3-yl)-N-(3-piperazin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66551695 |
| Molecular Formula | C25H28ClN7 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 4-(5-chloro-7-methyl-1-propylpyrrolo[3,2-b]pyridin-3-yl)-N-(3-piperazin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | CCCn1cc(-c2ccnc(Nc3cccc(N4CCNCC4)c3)n2)c2nc(Cl)cc(C)c21 |
| InChI | InChI=1S/C25H28ClN7/c1-3-11-33-16-20(23-24(33)17(2)14-22(26)31-23)21-7-8-28-25(30-21)29-18-5-4-6-19(15-18)32-12-9-27-10-13-32/h4-8,14-16,27H,3,9-13H2,1-2H3,(H,28,29,30) |
| InChIKey | UEXYAHAFWFKBTI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|