C24H26N6O — CID 67445017
N-(4-morpholin-4-ylphenyl)-4-(1-propylpyrrolo[2,3-c]pyridin-3-yl)pyrimidin-2-amine (PubChem CID 67445017) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4-(1-propylpyrrolo[2,3-c]pyridin-3-yl)pyrimidin-2-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4-(1-propylpyrrolo[2,3-c]pyridin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 67445017 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4-(1-propylpyrrolo[2,3-c]pyridin-3-yl)pyrimidin-2-amine |
| SMILES | CCCn1cc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)c2ccncc21 |
| InChI | InChI=1S/C24H26N6O/c1-2-11-30-17-21(20-7-9-25-16-23(20)30)22-8-10-26-24(28-22)27-18-3-5-19(6-4-18)29-12-14-31-15-13-29/h3-10,16-17H,2,11-15H2,1H3,(H,26,27,28) |
| InChIKey | LQHRAEINHKNGDY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|