C24H26N6 — CID 58367886
4-(1-propan-2-ylpyrrolo[2,3-c]pyridin-3-yl)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 58367886) has the molecular formula C24H26N6 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-(1-propan-2-ylpyrrolo[2,3-c]pyridin-3-yl)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(1-propan-2-ylpyrrolo[2,3-c]pyridin-3-yl)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 58367886 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 4-(1-propan-2-ylpyrrolo[2,3-c]pyridin-3-yl)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | CC(C)n1cc(-c2ccnc(Nc3ccc(N4CCCC4)cc3)n2)c2ccncc21 |
| InChI | InChI=1S/C24H26N6/c1-17(2)30-16-21(20-9-11-25-15-23(20)30)22-10-12-26-24(28-22)27-18-5-7-19(8-6-18)29-13-3-4-14-29/h5-12,15-17H,3-4,13-14H2,1-2H3,(H,26,27,28) |
| InChIKey | BWHPRKWGEQJHQI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|