C24H27ClN6O2 — CID 69321955
3-[[4-(3-chloro-N-methylanilino)pyrimidin-2-yl]amino]-N-ethyl-5-morpholin-4-ylbenzamide (PubChem CID 69321955) has the molecular formula C24H27ClN6O2 and a molecular weight of 466.97 g/mol. Its IUPAC name is 3-[[4-(3-chloro-N-methylanilino)pyrimidin-2-yl]amino]-N-ethyl-5-morpholin-4-ylbenzamide.
| Compound Name | 3-[[4-(3-chloro-N-methylanilino)pyrimidin-2-yl]amino]-N-ethyl-5-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 69321955 |
| Molecular Formula | C24H27ClN6O2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 3-[[4-(3-chloro-N-methylanilino)pyrimidin-2-yl]amino]-N-ethyl-5-morpholin-4-ylbenzamide |
| SMILES | CCNC(=O)c1cc(Nc2nccc(N(C)c3cccc(Cl)c3)n2)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C24H27ClN6O2/c1-3-26-23(32)17-13-19(16-21(14-17)31-9-11-33-12-10-31)28-24-27-8-7-22(29-24)30(2)20-6-4-5-18(25)15-20/h4-8,13-16H,3,9-12H2,1-2H3,(H,26,32)(H,27,28,29) |
| InChIKey | RUCRBQADBTWYGO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |