C33H40N6O6S — CID 87689342
benzenesulfonic acid;[3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]methylamino]-4-methylphenyl]methanol (PubChem CID 87689342) has the molecular formula C33H40N6O6S and a molecular weight of 648.79 g/mol. Its IUPAC name is benzenesulfonic acid;[3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]methylamino]-4-methylphenyl]methanol.
| Compound Name | benzenesulfonic acid;[3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]methylamino]-4-methylphenyl]methanol |
|---|---|
| PubChem CID | 87689342 |
| Molecular Formula | C33H40N6O6S |
| Molecular Weight | 648.79 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | benzenesulfonic acid;[3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]methylamino]-4-methylphenyl]methanol |
| SMILES | Cc1ccc(CO)cc1NCc1ccnc(Nc2cc(N3CCOCC3)cc(N3CCOCC3)c2)n1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C27H34N6O3.C6H6O3S/c1-20-2-3-21(19-34)14-26(20)29-18-22-4-5-28-27(30-22)31-23-15-24(32-6-10-35-11-7-32)17-25(16-23)33-8-12-36-13-9-33;7-10(8,9)6-4-2-1-3-5-6/h2-5,14-17,29,34H,6-13,18-19H2,1H3,(H,28,30,31);1-5H,(H,7,8,9) |
| InChIKey | BWZYKYCJBBZYGW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 149.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|