C32H36N6O5S — CID 87689630
[3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]methylamino]-4-methylphenyl] benzenesulfonate (PubChem CID 87689630) has the molecular formula C32H36N6O5S and a molecular weight of 616.74 g/mol. Its IUPAC name is [3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]methylamino]-4-methylphenyl] benzenesulfonate.
| Compound Name | [3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]methylamino]-4-methylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 87689630 |
| Molecular Formula | C32H36N6O5S |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | [3-[[2-(3,5-dimorpholin-4-ylanilino)pyrimidin-4-yl]methylamino]-4-methylphenyl] benzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2ccccc2)cc1NCc1ccnc(Nc2cc(N3CCOCC3)cc(N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C32H36N6O5S/c1-24-7-8-29(43-44(39,40)30-5-3-2-4-6-30)22-31(24)34-23-25-9-10-33-32(35-25)36-26-19-27(37-11-15-41-16-12-37)21-28(20-26)38-13-17-42-18-14-38/h2-10,19-22,34H,11-18,23H2,1H3,(H,33,35,36) |
| InChIKey | VBYVNLQSIQBMIV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|