C24H29N5 — CID 112920129
6-methyl-4-N-(2-phenylethyl)-2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112920129) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is 6-methyl-4-N-(2-phenylethyl)-2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-(2-phenylethyl)-2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112920129 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 6-methyl-4-N-(2-phenylethyl)-2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NCCc2ccccc2)nc(Nc2ccc(N3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C24H29N5/c1-19-18-23(25-15-14-20-8-4-2-5-9-20)28-24(26-19)27-21-10-12-22(13-11-21)29-16-6-3-7-17-29/h2,4-5,8-13,18H,3,6-7,14-17H2,1H3,(H2,25,26,27,28) |
| InChIKey | YSSXKVRSDRUUBH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|