C21H24N4 — CID 112924413
6-methyl-4-N-(3-methylphenyl)-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine (PubChem CID 112924413) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 6-methyl-4-N-(3-methylphenyl)-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-(3-methylphenyl)-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112924413 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 6-methyl-4-N-(3-methylphenyl)-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cccc(Nc2cc(C)nc(NCCCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H24N4/c1-16-8-6-12-19(14-16)24-20-15-17(2)23-21(25-20)22-13-7-11-18-9-4-3-5-10-18/h3-6,8-10,12,14-15H,7,11,13H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | HRMBJAWYUNVHHY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|