C16H23NO3 — CID 170733767
acetaldehyde;ethyl 4-methyl-3-pyrrolidin-3-ylbenzoate (PubChem CID 170733767) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is acetaldehyde;ethyl 4-methyl-3-pyrrolidin-3-ylbenzoate.
| Compound Name | acetaldehyde;ethyl 4-methyl-3-pyrrolidin-3-ylbenzoate |
|---|---|
| PubChem CID | 170733767 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | acetaldehyde;ethyl 4-methyl-3-pyrrolidin-3-ylbenzoate |
| SMILES | CC=O.CCOC(=O)c1ccc(C)c(C2CCNC2)c1 |
| InChI | InChI=1S/C14H19NO2.C2H4O/c1-3-17-14(16)11-5-4-10(2)13(8-11)12-6-7-15-9-12;1-2-3/h4-5,8,12,15H,3,6-7,9H2,1-2H3;2H,1H3 |
| InChIKey | LDAFYVCOCAUIEF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|