C21H18F6N2O3 — CID 171785454
[N-[4-methyl-3-[(3R)-pyrrolidin-3-yl]benzoyl]-3-(trifluoromethyl)anilino] 2,2,2-trifluoroacetate (PubChem CID 171785454) has the molecular formula C21H18F6N2O3 and a molecular weight of 460.37 g/mol. Its IUPAC name is [N-[4-methyl-3-[(3R)-pyrrolidin-3-yl]benzoyl]-3-(trifluoromethyl)anilino] 2,2,2-trifluoroacetate.
| Compound Name | [N-[4-methyl-3-[(3R)-pyrrolidin-3-yl]benzoyl]-3-(trifluoromethyl)anilino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 171785454 |
| Molecular Formula | C21H18F6N2O3 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [N-[4-methyl-3-[(3R)-pyrrolidin-3-yl]benzoyl]-3-(trifluoromethyl)anilino] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(=O)N(OC(=O)C(F)(F)F)c2cccc(C(F)(F)F)c2)cc1[C@H]1CCNC1 |
| InChI | InChI=1S/C21H18F6N2O3/c1-12-5-6-13(9-17(12)14-7-8-28-11-14)18(30)29(32-19(31)21(25,26)27)16-4-2-3-15(10-16)20(22,23)24/h2-6,9-10,14,28H,7-8,11H2,1H3/t14-/m0/s1 |
| InChIKey | LSSCFWTUUJWJSL-AWEZNQCLSA-N |
| XLogP | 4.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|