C20H16F3N3O4 — CID 87676399
1-[5-[methoxy-[3-(trifluoromethyl)phenyl]carbamoyl]-2-methylphenyl]imidazole-4-carboxylic acid (PubChem CID 87676399) has the molecular formula C20H16F3N3O4 and a molecular weight of 419.36 g/mol. Its IUPAC name is 1-[5-[methoxy-[3-(trifluoromethyl)phenyl]carbamoyl]-2-methylphenyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[5-[methoxy-[3-(trifluoromethyl)phenyl]carbamoyl]-2-methylphenyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 87676399 |
| Molecular Formula | C20H16F3N3O4 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-[5-[methoxy-[3-(trifluoromethyl)phenyl]carbamoyl]-2-methylphenyl]imidazole-4-carboxylic acid |
| SMILES | CON(C(=O)c1ccc(C)c(-n2cnc(C(=O)O)c2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3N3O4/c1-12-6-7-13(8-17(12)25-10-16(19(28)29)24-11-25)18(27)26(30-2)15-5-3-4-14(9-15)20(21,22)23/h3-11H,1-2H3,(H,28,29) |
| InChIKey | PYEDZXNTLVHFOD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|