C11H9F2N3O — CID 60757426
N-(3,4-difluorophenyl)-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 60757426) has the molecular formula C11H9F2N3O and a molecular weight of 237.21 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60757426 |
| Molecular Formula | C11H9F2N3O |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H9F2N3O/c1-6-8(5-14-16-6)11(17)15-7-2-3-9(12)10(13)4-7/h2-5H,1H3,(H,14,16)(H,15,17) |
| InChIKey | NFNCYVZXNICKPP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |