C18H16Cl2N4O3S — CID 3508977
2,4-dichloro-N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]benzamide (PubChem CID 3508977) has the molecular formula C18H16Cl2N4O3S and a molecular weight of 439.32 g/mol. Its IUPAC name is 2,4-dichloro-N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3508977 |
| Molecular Formula | C18H16Cl2N4O3S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 2,4-dichloro-N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]benzamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N4O3S/c1-2-15(25)21-12-6-3-10(4-7-12)16(26)23-24-18(28)22-17(27)13-8-5-11(19)9-14(13)20/h3-9H,2H2,1H3,(H,21,25)(H,23,26)(H2,22,24,27,28) |
| InChIKey | PTJIZRYMOBTURC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|