C19H25ClOS — CID 174778853
2-tert-butyl-4-(1-chloro-2-phenylethyl)-6-methylphenol;sulfane (PubChem CID 174778853) has the molecular formula C19H25ClOS and a molecular weight of 336.93 g/mol. Its IUPAC name is 2-tert-butyl-4-(1-chloro-2-phenylethyl)-6-methylphenol;sulfane.
| Compound Name | 2-tert-butyl-4-(1-chloro-2-phenylethyl)-6-methylphenol;sulfane |
|---|---|
| PubChem CID | 174778853 |
| Molecular Formula | C19H25ClOS |
| Molecular Weight | 336.93 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-tert-butyl-4-(1-chloro-2-phenylethyl)-6-methylphenol;sulfane |
| SMILES | Cc1cc(C(Cl)Cc2ccccc2)cc(C(C)(C)C)c1O.S |
| InChI | InChI=1S/C19H23ClO.H2S/c1-13-10-15(12-16(18(13)21)19(2,3)4)17(20)11-14-8-6-5-7-9-14;/h5-10,12,17,21H,11H2,1-4H3;1H2 |
| InChIKey | YUPKFMVHSCESBG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.93 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|