C30H38O4 — CID 18986362
methyl 5-[7-(6-methoxy-2-methyl-6-oxohexan-2-yl)anthracen-2-yl]-5-methylhexanoate (PubChem CID 18986362) has the molecular formula C30H38O4 and a molecular weight of 462.63 g/mol. Its IUPAC name is methyl 5-[7-(6-methoxy-2-methyl-6-oxohexan-2-yl)anthracen-2-yl]-5-methylhexanoate.
| Compound Name | methyl 5-[7-(6-methoxy-2-methyl-6-oxohexan-2-yl)anthracen-2-yl]-5-methylhexanoate |
|---|---|
| PubChem CID | 18986362 |
| Molecular Formula | C30H38O4 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | methyl 5-[7-(6-methoxy-2-methyl-6-oxohexan-2-yl)anthracen-2-yl]-5-methylhexanoate |
| SMILES | COC(=O)CCCC(C)(C)c1ccc2cc3ccc(C(C)(C)CCCC(=O)OC)cc3cc2c1 |
| InChI | InChI=1S/C30H38O4/c1-29(2,15-7-9-27(31)33-5)25-13-11-21-17-22-12-14-26(20-24(22)18-23(21)19-25)30(3,4)16-8-10-28(32)34-6/h11-14,17-20H,7-10,15-16H2,1-6H3 |
| InChIKey | SUQWUMZRYLWNLO-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|