C19H21F3O2 — CID 58252740
[6-(2-methylbutan-2-yl)naphthalen-2-yl] 4,4,4-trifluorobutanoate (PubChem CID 58252740) has the molecular formula C19H21F3O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is [6-(2-methylbutan-2-yl)naphthalen-2-yl] 4,4,4-trifluorobutanoate.
| Compound Name | [6-(2-methylbutan-2-yl)naphthalen-2-yl] 4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 58252740 |
| Molecular Formula | C19H21F3O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [6-(2-methylbutan-2-yl)naphthalen-2-yl] 4,4,4-trifluorobutanoate |
| SMILES | CCC(C)(C)c1ccc2cc(OC(=O)CCC(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C19H21F3O2/c1-4-18(2,3)15-7-5-14-12-16(8-6-13(14)11-15)24-17(23)9-10-19(20,21)22/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | AHRQPRWGDMDQBB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|