C29H40O5 — CID 22976480
[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]oxyphenyl] 2-methylbutanoate (PubChem CID 22976480) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is [4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]oxyphenyl] 2-methylbutanoate.
| Compound Name | [4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]oxyphenyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 22976480 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | [4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]oxyphenyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1ccc(OC(=O)COc2ccc(C(C)(C)CC)cc2C(C)(C)CC)cc1 |
| InChI | InChI=1S/C29H40O5/c1-9-20(4)27(31)34-23-15-13-22(14-16-23)33-26(30)19-32-25-17-12-21(28(5,6)10-2)18-24(25)29(7,8)11-3/h12-18,20H,9-11,19H2,1-8H3 |
| InChIKey | YKQBOEIKTIGERK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|