C18H28O3 — CID 19864942
methyl 5-(4-hydroxyphenyl)-5,7,7-trimethyloctanoate (PubChem CID 19864942) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is methyl 5-(4-hydroxyphenyl)-5,7,7-trimethyloctanoate.
| Compound Name | methyl 5-(4-hydroxyphenyl)-5,7,7-trimethyloctanoate |
|---|---|
| PubChem CID | 19864942 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | methyl 5-(4-hydroxyphenyl)-5,7,7-trimethyloctanoate |
| SMILES | COC(=O)CCCC(C)(CC(C)(C)C)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H28O3/c1-17(2,3)13-18(4,12-6-7-16(20)21-5)14-8-10-15(19)11-9-14/h8-11,19H,6-7,12-13H2,1-5H3 |
| InChIKey | BAAXFMLUGHSPMG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |