C15H22O3S — CID 19864989
methyl 5-(6-hydroxy-3-methyl-2-sulfanylphenyl)-5-methylhexanoate (PubChem CID 19864989) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is methyl 5-(6-hydroxy-3-methyl-2-sulfanylphenyl)-5-methylhexanoate.
| Compound Name | methyl 5-(6-hydroxy-3-methyl-2-sulfanylphenyl)-5-methylhexanoate |
|---|---|
| PubChem CID | 19864989 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | methyl 5-(6-hydroxy-3-methyl-2-sulfanylphenyl)-5-methylhexanoate |
| SMILES | COC(=O)CCCC(C)(C)c1c(O)ccc(C)c1S |
| InChI | InChI=1S/C15H22O3S/c1-10-7-8-11(16)13(14(10)19)15(2,3)9-5-6-12(17)18-4/h7-8,16,19H,5-6,9H2,1-4H3 |
| InChIKey | DLIIKAOBLBHZAY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|