C22H36O3 — CID 54404280
4-[2,6-diethyl-3-hydroxy-4-(2-methylheptan-2-yl)phenyl]butanoic acid (PubChem CID 54404280) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 4-[2,6-diethyl-3-hydroxy-4-(2-methylheptan-2-yl)phenyl]butanoic acid.
| Compound Name | 4-[2,6-diethyl-3-hydroxy-4-(2-methylheptan-2-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 54404280 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 4-[2,6-diethyl-3-hydroxy-4-(2-methylheptan-2-yl)phenyl]butanoic acid |
| SMILES | CCCCCC(C)(C)c1cc(CC)c(CCCC(=O)O)c(CC)c1O |
| InChI | InChI=1S/C22H36O3/c1-6-9-10-14-22(4,5)19-15-16(7-2)18(12-11-13-20(23)24)17(8-3)21(19)25/h15,25H,6-14H2,1-5H3,(H,23,24) |
| InChIKey | VPOISGJFTGUSFZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|