C20H32O3 — CID 54466436
3-[3-ethyl-4-methoxy-5-(2-methylheptan-2-yl)phenyl]propanoic acid (PubChem CID 54466436) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 3-[3-ethyl-4-methoxy-5-(2-methylheptan-2-yl)phenyl]propanoic acid.
| Compound Name | 3-[3-ethyl-4-methoxy-5-(2-methylheptan-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54466436 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 3-[3-ethyl-4-methoxy-5-(2-methylheptan-2-yl)phenyl]propanoic acid |
| SMILES | CCCCCC(C)(C)c1cc(CCC(=O)O)cc(CC)c1OC |
| InChI | InChI=1S/C20H32O3/c1-6-8-9-12-20(3,4)17-14-15(10-11-18(21)22)13-16(7-2)19(17)23-5/h13-14H,6-12H2,1-5H3,(H,21,22) |
| InChIKey | XFEWPQHEAJFJFI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|