C37H58O4 — CID 154091937
4,4-bis(4-hydroxy-2,5-dipentylphenyl)pentanoic acid (PubChem CID 154091937) has the molecular formula C37H58O4 and a molecular weight of 566.87 g/mol. Its IUPAC name is 4,4-bis(4-hydroxy-2,5-dipentylphenyl)pentanoic acid.
| Compound Name | 4,4-bis(4-hydroxy-2,5-dipentylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 154091937 |
| Molecular Formula | C37H58O4 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.43 |
| IUPAC Name | 4,4-bis(4-hydroxy-2,5-dipentylphenyl)pentanoic acid |
| SMILES | CCCCCc1cc(C(C)(CCC(=O)O)c2cc(CCCCC)c(O)cc2CCCCC)c(CCCCC)cc1O |
| InChI | InChI=1S/C37H58O4/c1-6-10-14-18-28-26-34(38)30(20-16-12-8-3)24-32(28)37(5,23-22-36(40)41)33-25-31(21-17-13-9-4)35(39)27-29(33)19-15-11-7-2/h24-27,38-39H,6-23H2,1-5H3,(H,40,41) |
| InChIKey | DNURBLFAGSIRFO-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|