C13H14FNO3 — CID 107936566
ethyl 4-(3-cyano-4-fluorophenyl)-4-hydroxybutanoate (PubChem CID 107936566) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is ethyl 4-(3-cyano-4-fluorophenyl)-4-hydroxybutanoate.
| Compound Name | ethyl 4-(3-cyano-4-fluorophenyl)-4-hydroxybutanoate |
|---|---|
| PubChem CID | 107936566 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | ethyl 4-(3-cyano-4-fluorophenyl)-4-hydroxybutanoate |
| SMILES | CCOC(=O)CCC(O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C13H14FNO3/c1-2-18-13(17)6-5-12(16)9-3-4-11(14)10(7-9)8-15/h3-4,7,12,16H,2,5-6H2,1H3 |
| InChIKey | MSULIWLIENZIEL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |