C12H17FN2O2 — CID 82117394
4-(3-amino-4-fluorophenyl)-4-hydroxy-N,N-dimethylbutanamide (PubChem CID 82117394) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-(3-amino-4-fluorophenyl)-4-hydroxy-N,N-dimethylbutanamide.
| Compound Name | 4-(3-amino-4-fluorophenyl)-4-hydroxy-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 82117394 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 4-(3-amino-4-fluorophenyl)-4-hydroxy-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCC(O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C12H17FN2O2/c1-15(2)12(17)6-5-11(16)8-3-4-9(13)10(14)7-8/h3-4,7,11,16H,5-6,14H2,1-2H3 |
| InChIKey | APERTPGEBKXIJD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|