About 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide
4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide (PubChem CID 82120602) has the molecular formula C12H17ClN2O2
and a molecular weight of 256.73 g/mol. Its IUPAC name is 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide |
| PubChem CID | 82120602 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCC(O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C12H17ClN2O2/c1-15(2)12(17)6-5-11(16)8-3-4-9(13)10(14)7-8/h3-4,7,11,16H,5-6,14H2,1-2H3 |
| InChIKey | BDMDLEPNRCYTPN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide?
The IUPAC name of 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide (CID 82120602) is 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide.
What is the SMILES notation for 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide?
The canonical SMILES for 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide is CN(C)C(=O)CCC(O)c1ccc(Cl)c(N)c1.
What is the InChIKey of 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide?
The InChIKey is BDMDLEPNRCYTPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN2O2/c1-15(2)12(17)6-5-11(16)8-3-4-9(13)10(14)7-8/h3-4,7,11,16H,5-6,14H2,1-2H3.
What are the key properties of 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide?
4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide has a molecular weight of 256.73 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-4-chlorophenyl)-4-hydroxy-N,N-dimethylbutanamide is sourced from PubChem (CID 82120602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).