C14H14O5S — CID 170822664
S-[2,3-dihydroxy-3-(4-oxochromen-6-yl)propyl] ethanethioate (PubChem CID 170822664) has the molecular formula C14H14O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(4-oxochromen-6-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(4-oxochromen-6-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822664 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | S-[2,3-dihydroxy-3-(4-oxochromen-6-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc2occc(=O)c2c1 |
| InChI | InChI=1S/C14H14O5S/c1-8(15)20-7-12(17)14(18)9-2-3-13-10(6-9)11(16)4-5-19-13/h2-6,12,14,17-18H,7H2,1H3 |
| InChIKey | GSFYSHAEYGPBBH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|