C12H14N4O6 — CID 170827028
methyl 3-(3-azido-1,2-dihydroxypropyl)-2-methyl-5-nitrobenzoate (PubChem CID 170827028) has the molecular formula C12H14N4O6 and a molecular weight of 310.27 g/mol. Its IUPAC name is methyl 3-(3-azido-1,2-dihydroxypropyl)-2-methyl-5-nitrobenzoate.
| Compound Name | methyl 3-(3-azido-1,2-dihydroxypropyl)-2-methyl-5-nitrobenzoate |
|---|---|
| PubChem CID | 170827028 |
| Molecular Formula | C12H14N4O6 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | methyl 3-(3-azido-1,2-dihydroxypropyl)-2-methyl-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc(C(O)C(O)CN=[N+]=[N-])c1C |
| InChI | InChI=1S/C12H14N4O6/c1-6-8(11(18)10(17)5-14-15-13)3-7(16(20)21)4-9(6)12(19)22-2/h3-4,10-11,17-18H,5H2,1-2H3 |
| InChIKey | QBPHGZPEBKKGCT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|