C11H13NO6S — CID 170820838
methyl 2-(1,2-dihydroxy-3-sulfanylpropyl)-5-nitrobenzoate (PubChem CID 170820838) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is methyl 2-(1,2-dihydroxy-3-sulfanylpropyl)-5-nitrobenzoate.
| Compound Name | methyl 2-(1,2-dihydroxy-3-sulfanylpropyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 170820838 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | methyl 2-(1,2-dihydroxy-3-sulfanylpropyl)-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1C(O)C(O)CS |
| InChI | InChI=1S/C11H13NO6S/c1-18-11(15)8-4-6(12(16)17)2-3-7(8)10(14)9(13)5-19/h2-4,9-10,13-14,19H,5H2,1H3 |
| InChIKey | POHPWTFXZVCNAM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|