C10H13NO6 — CID 170818557
1-(2-methoxy-4-nitrophenyl)propane-1,2,3-triol (PubChem CID 170818557) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is 1-(2-methoxy-4-nitrophenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-methoxy-4-nitrophenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818557 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(2-methoxy-4-nitrophenyl)propane-1,2,3-triol |
| SMILES | COc1cc([N+](=O)[O-])ccc1C(O)C(O)CO |
| InChI | InChI=1S/C10H13NO6/c1-17-9-4-6(11(15)16)2-3-7(9)10(14)8(13)5-12/h2-4,8,10,12-14H,5H2,1H3 |
| InChIKey | YMQTUOZTIBEUHY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|