C16H19ClN4O4 — CID 171888226
benzyl N-[4-(3-amino-5-chloropyrazin-2-yl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888226) has the molecular formula C16H19ClN4O4 and a molecular weight of 366.81 g/mol. Its IUPAC name is benzyl N-[4-(3-amino-5-chloropyrazin-2-yl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(3-amino-5-chloropyrazin-2-yl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888226 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | benzyl N-[4-(3-amino-5-chloropyrazin-2-yl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Nc1nc(Cl)cnc1C(O)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19ClN4O4/c17-12-8-20-13(15(18)21-12)14(23)11(22)6-7-19-16(24)25-9-10-4-2-1-3-5-10/h1-5,8,11,14,22-23H,6-7,9H2,(H2,18,21)(H,19,24) |
| InChIKey | ANEGFHNHYXNBOM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |