C21H20N4O6 — CID 170833984
9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(5-nitro-1H-imidazol-4-yl)propyl]carbamate (PubChem CID 170833984) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(5-nitro-1H-imidazol-4-yl)propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(5-nitro-1H-imidazol-4-yl)propyl]carbamate |
|---|---|
| PubChem CID | 170833984 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(5-nitro-1H-imidazol-4-yl)propyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1nc[nH]c1[N+](=O)[O-])OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H20N4O6/c26-17(19(27)18-20(25(29)30)24-11-23-18)9-22-21(28)31-10-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,11,16-17,19,26-27H,9-10H2,(H,22,28)(H,23,24) |
| InChIKey | DJMFHRMBOADXQM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 150.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|