C28H26N2O5 — CID 170835007
9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(2-methoxyquinolin-6-yl)propyl]carbamate (PubChem CID 170835007) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(2-methoxyquinolin-6-yl)propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(2-methoxyquinolin-6-yl)propyl]carbamate |
|---|---|
| PubChem CID | 170835007 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(2-methoxyquinolin-6-yl)propyl]carbamate |
| SMILES | COc1ccc2cc(C(O)C(O)CNC(=O)OCC3c4ccccc4-c4ccccc43)ccc2n1 |
| InChI | InChI=1S/C28H26N2O5/c1-34-26-13-11-17-14-18(10-12-24(17)30-26)27(32)25(31)15-29-28(33)35-16-23-21-8-4-2-6-19(21)20-7-3-5-9-22(20)23/h2-14,23,25,27,31-32H,15-16H2,1H3,(H,29,33) |
| InChIKey | UJEJTCFUDMHJLH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |