C13H18N2O3S — CID 171875855
S-[4-(4-carbamimidoylphenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875855) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is S-[4-(4-carbamimidoylphenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(4-carbamimidoylphenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875855 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | S-[4-(4-carbamimidoylphenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | [H]/N=C(\N)c1ccc(C(O)C(O)CCSC(C)=O)cc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-8(16)19-7-6-11(17)12(18)9-2-4-10(5-3-9)13(14)15/h2-5,11-12,17-18H,6-7H2,1H3,(H3,14,15) |
| InChIKey | XVYXQDICQBJKQH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|