C18H28O3S — CID 171876731
S-[4-(4-hexylphenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876731) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is S-[4-(4-hexylphenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(4-hexylphenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876731 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | S-[4-(4-hexylphenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CCCCCCc1ccc(C(O)C(O)CCSC(C)=O)cc1 |
| InChI | InChI=1S/C18H28O3S/c1-3-4-5-6-7-15-8-10-16(11-9-15)18(21)17(20)12-13-22-14(2)19/h8-11,17-18,20-21H,3-7,12-13H2,1-2H3 |
| InChIKey | PERQKRITKGOPQJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|