C12H9N3S — CID 169484130
3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]prop-2-enenitrile (PubChem CID 169484130) has the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]prop-2-enenitrile.
| Compound Name | 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 169484130 |
| Molecular Formula | C12H9N3S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 3-[4-(2-amino-1,3-thiazol-4-yl)phenyl]prop-2-enenitrile |
| SMILES | N#CC=Cc1ccc(-c2csc(N)n2)cc1 |
| InChI | InChI=1S/C12H9N3S/c13-7-1-2-9-3-5-10(6-4-9)11-8-16-12(14)15-11/h1-6,8H,(H2,14,15) |
| InChIKey | BNMGCMUPRDDUJA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|