C12H13NO4 — CID 117341851
2-(3-cyano-4,5-dimethoxyphenyl)propanoic acid (PubChem CID 117341851) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(3-cyano-4,5-dimethoxyphenyl)propanoic acid.
| Compound Name | 2-(3-cyano-4,5-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117341851 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(3-cyano-4,5-dimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(C(C)C(=O)O)cc(C#N)c1OC |
| InChI | InChI=1S/C12H13NO4/c1-7(12(14)15)8-4-9(6-13)11(17-3)10(5-8)16-2/h4-5,7H,1-3H3,(H,14,15) |
| InChIKey | GYLBHQHIKWFNPS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |