C34H30O22S2 — CID 139921391
pentamethyl 6-[[2,3,4,5,6-pentakis(methoxycarbonyl)benzoyl]disulfanyl]carbonylbenzene-1,2,3,4,5-pentacarboxylate (PubChem CID 139921391) has the molecular formula C34H30O22S2 and a molecular weight of 854.73 g/mol. Its IUPAC name is pentamethyl 6-[[2,3,4,5,6-pentakis(methoxycarbonyl)benzoyl]disulfanyl]carbonylbenzene-1,2,3,4,5-pentacarboxylate.
| Compound Name | pentamethyl 6-[[2,3,4,5,6-pentakis(methoxycarbonyl)benzoyl]disulfanyl]carbonylbenzene-1,2,3,4,5-pentacarboxylate |
|---|---|
| PubChem CID | 139921391 |
| Molecular Formula | C34H30O22S2 |
| Molecular Weight | 854.73 g/mol |
| Exact Mass | 854.07 |
| IUPAC Name | pentamethyl 6-[[2,3,4,5,6-pentakis(methoxycarbonyl)benzoyl]disulfanyl]carbonylbenzene-1,2,3,4,5-pentacarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(C(=O)OC)c(C(=O)SSC(=O)c2c(C(=O)OC)c(C(=O)OC)c(C(=O)OC)c(C(=O)OC)c2C(=O)OC)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C34H30O22S2/c1-47-23(35)11-13(25(37)49-3)17(29(41)53-7)21(18(30(42)54-8)14(11)26(38)50-4)33(45)57-58-34(46)22-19(31(43)55-9)15(27(39)51-5)12(24(36)48-2)16(28(40)52-6)20(22)32(44)56-10/h1-10H3 |
| InChIKey | YWORKOCGNSBEAO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 297.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.73 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|