C12H15NO5 — CID 15448288
dimethyl 2,4,6-trimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate (PubChem CID 15448288) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is dimethyl 2,4,6-trimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate.
| Compound Name | dimethyl 2,4,6-trimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15448288 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | dimethyl 2,4,6-trimethyl-1-oxidopyridin-1-ium-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(C)c(C(=O)OC)c(C)[n+]([O-])c1C |
| InChI | InChI=1S/C12H15NO5/c1-6-9(11(14)17-4)7(2)13(16)8(3)10(6)12(15)18-5/h1-5H3 |
| InChIKey | FAINDKONHMEIAB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|