C14H19NO3 — CID 134841692
ethyl 1,3-dimethyl-2-oxido-5,6,7,8-tetrahydroisoquinolin-2-ium-4-carboxylate (PubChem CID 134841692) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethyl 1,3-dimethyl-2-oxido-5,6,7,8-tetrahydroisoquinolin-2-ium-4-carboxylate.
| Compound Name | ethyl 1,3-dimethyl-2-oxido-5,6,7,8-tetrahydroisoquinolin-2-ium-4-carboxylate |
|---|---|
| PubChem CID | 134841692 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | ethyl 1,3-dimethyl-2-oxido-5,6,7,8-tetrahydroisoquinolin-2-ium-4-carboxylate |
| SMILES | CCOC(=O)c1c2c(c(C)[n+]([O-])c1C)CCCC2 |
| InChI | InChI=1S/C14H19NO3/c1-4-18-14(16)13-10(3)15(17)9(2)11-7-5-6-8-12(11)13/h4-8H2,1-3H3 |
| InChIKey | HLVKSTPRKJIQAB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 53.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|