C17H15Cl3N2O6 — CID 160953630
methyl 4-amino-2-chloro-6-methylbenzoate;methyl 2,6-dichloro-4-nitrobenzoate (PubChem CID 160953630) has the molecular formula C17H15Cl3N2O6 and a molecular weight of 449.67 g/mol. Its IUPAC name is methyl 4-amino-2-chloro-6-methylbenzoate;methyl 2,6-dichloro-4-nitrobenzoate.
| Compound Name | methyl 4-amino-2-chloro-6-methylbenzoate;methyl 2,6-dichloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 160953630 |
| Molecular Formula | C17H15Cl3N2O6 |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | methyl 4-amino-2-chloro-6-methylbenzoate;methyl 2,6-dichloro-4-nitrobenzoate |
| SMILES | COC(=O)c1c(C)cc(N)cc1Cl.COC(=O)c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C9H10ClNO2.C8H5Cl2NO4/c1-5-3-6(11)4-7(10)8(5)9(12)13-2;1-15-8(12)7-5(9)2-4(11(13)14)3-6(7)10/h3-4H,11H2,1-2H3;2-3H,1H3 |
| InChIKey | SWBZIPIVYGUVIW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|