C15H13N3O5 — CID 88690561
carbamoyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate (PubChem CID 88690561) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is carbamoyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate.
| Compound Name | carbamoyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 88690561 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | carbamoyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate |
| SMILES | Cc1cc(-c2cccc([N+](=O)[O-])c2)c(C(=O)OC(N)=O)c(C)n1 |
| InChI | InChI=1S/C15H13N3O5/c1-8-6-12(10-4-3-5-11(7-10)18(21)22)13(9(2)17-8)14(19)23-15(16)20/h3-7H,1-2H3,(H2,16,20) |
| InChIKey | IWYVNWGXRUATDD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|