C30H37N3O7P+ — CID 56610133
2-[benzyl(methyl)amino]ethyl 5-(2-hydroxy-4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-ium-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate (PubChem CID 56610133) has the molecular formula C30H37N3O7P+ and a molecular weight of 582.61 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]ethyl 5-(2-hydroxy-4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-ium-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate.
| Compound Name | 2-[benzyl(methyl)amino]ethyl 5-(2-hydroxy-4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-ium-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 56610133 |
| Molecular Formula | C30H37N3O7P+ |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | 2-[benzyl(methyl)amino]ethyl 5-(2-hydroxy-4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-ium-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate |
| SMILES | Cc1nc(C)c([P+]2(O)OC(C)(C)C(C)(C)O2)c(-c2cccc([N+](=O)[O-])c2)c1C(=O)OCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C30H37N3O7P/c1-20-25(28(34)38-17-16-32(7)19-22-12-9-8-10-13-22)26(23-14-11-15-24(18-23)33(35)36)27(21(2)31-20)41(37)39-29(3,4)30(5,6)40-41/h8-15,18,37H,16-17,19H2,1-7H3/q+1 |
| InChIKey | XWCWUIMAXDQMKF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|