C26H30N4O5 — CID 173399094
5-[1-[2-[benzyl(methyl)amino]ethoxyamino]ethylidene]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3-carboxylic acid (PubChem CID 173399094) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is 5-[1-[2-[benzyl(methyl)amino]ethoxyamino]ethylidene]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 5-[1-[2-[benzyl(methyl)amino]ethoxyamino]ethylidene]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 173399094 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 5-[1-[2-[benzyl(methyl)amino]ethoxyamino]ethylidene]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C1=C(C)NOCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C26H30N4O5/c1-17-23(19(3)28-35-14-13-29(4)16-20-9-6-5-7-10-20)25(24(26(31)32)18(2)27-17)21-11-8-12-22(15-21)30(33)34/h5-12,15,25,28H,13-14,16H2,1-4H3,(H,31,32) |
| InChIKey | CPBBHAJVRVIMKU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|