C25H34N2O8P+ — CID 56623023
2-propoxyethyl 5-(2-hydroxy-4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-ium-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate (PubChem CID 56623023) has the molecular formula C25H34N2O8P+ and a molecular weight of 521.53 g/mol. Its IUPAC name is 2-propoxyethyl 5-(2-hydroxy-4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-ium-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate.
| Compound Name | 2-propoxyethyl 5-(2-hydroxy-4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-ium-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 56623023 |
| Molecular Formula | C25H34N2O8P+ |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-propoxyethyl 5-(2-hydroxy-4,4,5,5-tetramethyl-1,3,2-dioxaphospholan-2-ium-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate |
| SMILES | CCCOCCOC(=O)c1c(C)nc(C)c([P+]2(O)OC(C)(C)C(C)(C)O2)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H34N2O8P/c1-8-12-32-13-14-33-23(28)20-16(2)26-17(3)22(36(31)34-24(4,5)25(6,7)35-36)21(20)18-10-9-11-19(15-18)27(29)30/h9-11,15,31H,8,12-14H2,1-7H3/q+1 |
| InChIKey | JCWYELAXHPMAAZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|