C22H28N2O7P+ — CID 56617235
methyl 5-(5,5-diethyl-2-hydroxy-1,3,2-dioxaphosphinan-2-ium-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate (PubChem CID 56617235) has the molecular formula C22H28N2O7P+ and a molecular weight of 463.45 g/mol. Its IUPAC name is methyl 5-(5,5-diethyl-2-hydroxy-1,3,2-dioxaphosphinan-2-ium-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-(5,5-diethyl-2-hydroxy-1,3,2-dioxaphosphinan-2-ium-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 56617235 |
| Molecular Formula | C22H28N2O7P+ |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | methyl 5-(5,5-diethyl-2-hydroxy-1,3,2-dioxaphosphinan-2-ium-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate |
| SMILES | CCC1(CC)CO[P+](O)(c2c(C)nc(C)c(C(=O)OC)c2-c2ccccc2[N+](=O)[O-])OC1 |
| InChI | InChI=1S/C22H28N2O7P/c1-6-22(7-2)12-30-32(28,31-13-22)20-15(4)23-14(3)18(21(25)29-5)19(20)16-10-8-9-11-17(16)24(26)27/h8-11,28H,6-7,12-13H2,1-5H3/q+1 |
| InChIKey | VEVJHPGOOFHSPC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|