C24H24N4O6 — CID 163381594
2-methoxyethyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(pyridin-4-ylmethylcarbamoyl)pyridine-3-carboxylate (PubChem CID 163381594) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-methoxyethyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(pyridin-4-ylmethylcarbamoyl)pyridine-3-carboxylate.
| Compound Name | 2-methoxyethyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(pyridin-4-ylmethylcarbamoyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 163381594 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-methoxyethyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(pyridin-4-ylmethylcarbamoyl)pyridine-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)nc(C)c(C(=O)NCc2ccncc2)c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H24N4O6/c1-15-20(23(29)26-14-17-8-10-25-11-9-17)22(18-6-4-5-7-19(18)28(31)32)21(16(2)27-15)24(30)34-13-12-33-3/h4-11H,12-14H2,1-3H3,(H,26,29) |
| InChIKey | OIRKADHBKNQEJY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|