C26H17F6N3O3 — CID 175986787
4-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrrole-3-carboxamide (PubChem CID 175986787) has the molecular formula C26H17F6N3O3 and a molecular weight of 533.43 g/mol. Its IUPAC name is 4-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175986787 |
| Molecular Formula | C26H17F6N3O3 |
| Molecular Weight | 533.43 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 4-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrrole-3-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1c[nH]c(-c2ccc(C(F)(F)F)cc2)c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H17F6N3O3/c27-25(28,29)17-9-5-15(6-10-17)13-34-24(36)20-14-33-23(16-7-11-18(12-8-16)26(30,31)32)22(20)19-3-1-2-4-21(19)35(37)38/h1-12,14,33H,13H2,(H,34,36) |
| InChIKey | ATBRZUOEKMQHPY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.43 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|